Benperidol

Formula:
C22H24FN3O2
CAS Number(s):
2062-84-2
SMILES code:

Fc1ccc(cc1)C(=O)CCCN1CCC(CC1)n1c(=O)[nH]c2ccccc12

Source:
Pharm Eu 6.2