Benfluorex hydrochloride

Formula:
C19H21ClF3NO2
CAS Number(s):
23642-66-2
SMILES code:

Cl.CC(NCCOC(=O)c1ccccc1)Cc1cccc(c1)C(F)(F)F

Source:
Pharm Eu 6.2