Bendroflumethiazide

Formula:
C15H14F3N3O4S2
CAS Number(s):
73-48-3
SMILES code:

NS(=O)(=O)c1cc2c(NC(Cc3ccccc3)NS2(=O)=O)cc1C(F)(F)F

Source:
Pharm Eu 6.2