Beclometasone dipropionate

Formula:
C28H37ClO7
CAS Number(s):
5534-09-8
SMILES code:

CCC(=O)OC1(C(C)CC2C3CCC4=CC(=O)C=CC4(C)C3(Cl)C(O)CC12C)C(=O)COC(=O)CC

Stoichiometry:
1/1
Monographed:
x
Source:
Pharm Eu 6.2