Bambuterol hydrochloride

Formula:
C18H30ClN3O5
CAS Number(s):
81732-46-9
SMILES code:

Cl.OC(CNC(C)(C)C)c1cc(cc(OC(=O)N(C)C)c1)OC(=O)N(C)C

Source:
Pharm Eu 6.2