Bacampicillin hydrochloride

Formula:
C21H28ClN3O7S
CAS Number(s):
37661-08-8
SMILES code:

Cl.CCOC(=O)OC(C)OC(=O)[C@@H]1N2C(=O)[C@@H](NC(=O)[C@H](N)c3ccccc3)[C@@H]2SC 1(C)C

Source:
Pharm Eu 6.2