Azelastine hydrochloride

Formula:
C22H25Cl2N3O
CAS Number(s):
79307-93-0
SMILES code:

Cl.CN1CCCC(CC1)n1nc(Cc2ccc(Cl)cc2)c2ccccc2c1=O

Stoichiometry:
possibly
Source:
Pharm Eu 6.2