Azathioprine

Formula:
C9H7N7O2S
CAS Number(s):
446-86-6
SMILES code:

Cn1cnc([N+](=O)[O-])c1Sc1ncnc2nc[nH]c12

Stoichiometry:
2/1
Source:
Pharm Eu 6.2
Crystal Structure DOI(s):
10.1002/jps.2600640206