Atropine sulphate

Formula:
C17H25NO7S
CAS Number(s):
55-48-1
SMILES code:

OCC(C(=O)OC1CC2CCC(C1)N2C)c1ccccc1.OS(=O)(=O)O

Source:
Pharm Eu 6.2