Atropine

Formula:
C17H23NO3
CAS Number(s):
101-31-5, 51-55-8
SMILES code:

OCC(C(=O)OC1CC2CCC(C1)N2C)c1ccccc1

Source:
Pharm Eu 6.2