Atenolol

Formula:
C14H22N2O3
CAS Number(s):
29122-68-7, 60966-51-0
SMILES code:

OC(CNC(C)C)COc1ccc(cc1)CC(=O)N

Source:
Pharm Eu 6.2