Ascorbic acid

Formula:
C6H8O6
CAS Number(s):
50-81-7
SMILES code:

OC[C@H](O)[C@H]1OC(=O)C(=C1O)O

Source:
Pharm Eu 6.2