Articaine hydrochloride

Formula:
C13H21ClN2O3S
CAS Number(s):
23964-57-0
SMILES code:

Cl.CCCNC(C)C(=O)Nc1c(C)csc1C(=O)OC

Source:
Pharm Eu 6.2