Arginine hydrochloride

Formula:
C6H15ClN4O2
CAS Number(s):
1119-34-2, 627-75-8
SMILES code:

Cl.NC(=N)NCCC[C@H](N)C(=O)O

Stoichiometry:
1/1 (L)
Source:
Pharm Eu 6.2
Crystal Structure CSD Code(s):
ARGHCL01
Crystal Structure DOI(s):
10.1107/S0567740870004697
IR Spectrum DOI(s):
10.1002/crat.200711133, 10.1016/S0254-0584(98)00169-2
DSC DOI(s):
10.1002/crat.200711133, 10.1016/S0254-0584(98)00169-2
TGA DOI(s):
10.1002/crat.200711133, 10.1016/S0254-0584(98)00169-2