Arginine aspartate

Formula:
C10H21N5O6
CAS Number(s):
7675-83-4
SMILES code:

OC(=O)C[C@H](N)C(=O)O.NC(=N)NCCC[C@H](N)C(=O)O

Source:
Pharm Eu 6.2