Antazoline hydrochloride

Formula:
C17H20ClN3
CAS Number(s):
2508-72-7
SMILES code:

Cl.c1ccc(cc1)CN(CC1=NCCN1)c1ccccc1

Source:
Pharm Eu 6.2