Ampicillin sodium

Formula:
C16H18N3NaO4S
CAS Number(s):
69-52-3
SMILES code:

[Na+].NC(c1ccccc1)C(=O)NC1C(=O)N2C1SC(C)(C)C2C(=O)[O-]

Source:
Pharm Eu 6.2