Amphotericin B

Formula:
C47H73NO17
CAS Number(s):
1397-89-3
SMILES code:

O[C@@H]1CC[C@@H](O)[C@H](O)C[C@H](O)C[C@@]2(O)C[C@H](O)[C@@H](C(=O)O)[C@@H] (C[C@H](C=CC=CC=CC=CC=CC=CC=C[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC(=O)C[C@H] (O)C1)OC1OC(C)C(O)C(N)C1O)O2

Source:
Pharm Eu 6.2
Crystal Structure DOI(s):
10.1107/S0567740878003350