Amoxicillin sodium

Formula:
C16H18N3O5SNa
CAS Number(s):
34642-77-8
SMILES code:

[Na+].Oc1ccc(cc1)C(N)C(=O)NC1C(=O)N2C1SC(C)(C)C2C(=O)O

Source:
Pharm Eu 6.2