Amoxicillin

Formula:
C16H19N3O5S
CAS Number(s):
26787-78-0
SMILES code:

Oc1ccc(cc1)C(N)C(=O)NC1C(=O)N2C1SC(C)(C)C2C(=O)O

Stoichiometry:
3/1
Monographed:
x
Source:
Pharm Eu 6.2
Crystal Structure CSD Code(s):
AMOXCT10