Amobarbital sodium

Formula:
C11 H17 N2 O3 Na
CAS Number(s):
64-43-7
SMILES code:

[Na+].CCC1(CCC(C)C)C(=O)NC(=O)NC1=O

Source:
Pharm Eu 6.2