Amobarbital

Formula:
C11H18N2O3
CAS Number(s):
57-43-2
SMILES code:

CCC1(CCC(C)C)C(=O)NC(=O)NC1=O

Source:
Pharm Eu 6.2