Amlodipine besilate

Formula:
C26H31ClN2O8S
CAS Number(s):
111470-99-6, 88150-42-9
SMILES code:

NCCOCC1=C(C(=O)OCC)C(C(=C(C)N1)C(=O)OC)c1ccccc1Cl.OS(=O)(=O)c1ccccc1

Stoichiometry:
2/1
Source:
Pharm Eu 6.2
Crystal Structure CSD Code(s):
INEDUB
Crystal Structure DOI(s):
10.1021/cg101127z
Powder Spectrum DOI(s):
10.1021/cg101127z
IR Spectrum DOI(s):
10.1021/cg101127z
Raman Spectrum DOI(s):
10.1021/cg101127z
DSC DOI(s):
10.1021/cg101127z
TGA DOI(s):
10.1021/cg101127z