Amlodipine besilate

Formula:
C26H31ClN2O8S
CAS Number(s):
111470-99-6, 88150-42-9
SMILES code:

NCCOCC1=C(C(=O)OCC)C(C(=C(C)N1)C(=O)OC)c1ccccc1Cl.OS(=O)(=O)c1ccccc1

Stoichiometry:
1/1
Source:
Pharm Eu 6.2
Powder Spectrum DOI(s):
10.1023/A:1016067130634
IR Spectrum DOI(s):
10.1023/A:1016067130634
Raman Spectrum DOI(s):
10.1023/A:1016067130634
DSC DOI(s):
10.1023/A:1016067130634
TGA DOI(s):
10.1023/A:1016067130634
Moisture DOI(s):
10.1023/A:1016067130634