Amisulpride

Formula:
C17H27N3O4S
CAS Number(s):
71675-85-9
SMILES code:

CCN1CCCC1CNC(=O)c1cc(c(N)cc1OC)S(=O)(=O)CC

Source:
Pharm Eu 6.2