Amiodarone hydrochloride

Formula:
C25H30ClI2NO3
CAS Number(s):
1951-25-3, 19774-82-4
SMILES code:

Cl.CCCCc1oc2ccccc2c1C(=O)c1cc(I)c(OCCN(CC)CC)c(I)c1

Source:
Pharm Eu 6.2