Aminoglutethimide

Formula:
C13H16N2O2
CAS Number(s):
125-84-8
SMILES code:

CCC1(CCC(=O)NC1=O)c1ccc(N)cc1

Source:
Pharm Eu 6.2