Amiloride hydrochloride

Formula:
C6H9Cl2N7O
CAS Number(s):
2016-88-8
SMILES code:

Cl.NC(=N)NC(=O)c1nc(Cl)c(N)nc1N

Stoichiometry:
2/1 (polymorphic)
Source:
Pharm Eu 6.2
Powder Spectrum DOI(s):
10.1016/0378-5173(93)90339-H
IR Spectrum DOI(s):
10.1016/0378-5173(93)90339-H
Moisture DOI(s):
10.1016/0378-5173(93)90339-H