Amikacin sulphate

Formula:
C22H45N5O17S
CAS Number(s):
149022-22-0
SMILES code:

O=S(=O)(O)O.O=C(N[C@H]3[C@H](O[C@H]1O[C@@H]([C@@H](O)[C@H](N)[C@H]1O)CO)[C@@H](O)[C@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](N)C3)[C@@H](O)CCN

Source:
Pharm Eu 6.2