Amfetamine sulphate

Formula:
C9H13N
CAS Number(s):
300-62-9, 405-41-4
SMILES code:

C[C@H](N)Cc1ccccc1.OS(=O)(=O)O.OS(=O)(=O)O

Source:
Pharm Eu 6.2