Ambroxol hydrochloride

Formula:
C13H19Br2ClN2O
CAS Number(s):
18683-91-5, 23828-92-4
SMILES code:

Cl.OC1CCC(CC1)NCc1cc(Br)cc(Br)c1N

Source:
Pharm Eu 6.2