Alverine citrate

Formula:
C26H35NO7
CAS Number(s):
5560-59-8
SMILES code:

CCN(CCCc1ccccc1)CCCc1ccccc1.OC(=O)CC(O)(CC(=O)O)C(=O)O

Source:
Pharm Eu 6.2