Altizide

Formula:
C11H14ClN3O4S3
CAS Number(s):
5588-16-9
SMILES code:

C=CCSCC1NC2=CC(=C(C=C2S(=O)(=O)N1)S(=O)(=O)N)Cl

Source:
Pharm Eu 6.2