Alprostadil

Formula:
C20H34O5
CAS Number(s):
745-65-3
SMILES code:

CCCCC[C@H](O)/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(=O)O

Source:
Pharm Eu 6.2