Alprenolol hydrochloride

Formula:
C15H24ClNO2
CAS Number(s):
13707-88-5
SMILES code:

Cl.C=CCc1ccccc1OCC(O)CNC(C)C

Source:
Pharm Eu 6.2