Alprazolam

Formula:
C17H13ClN4
CAS Number(s):
28981-97-7
SMILES code:

Clc1ccc2c(c1)C(=NCc1nnc(C)n21)c1ccccc1

Stoichiometry:
2/1
Source:
Pharm Eu 6.2
Crystal Structure DOI(s):
10.1002/jps.2600841121, 10.1107/S0108270199010446
DSC DOI(s):
10.1002/jps.2600841121