all-rac-alpha Tocopherol acetate

Formula:
C31H52O3
CAS Number(s):
52225-20-4, 58-95-7, 7695-91-2
SMILES code:

C[C@H](CCC[C@H](C)CCCC(C)C)CCC[C@]1(C)CCc2c(O1)c(C)c(C)c(OC(=O)C)c2C

Source:
Pharm Eu 6.2