all-rac-alpha Tocopherol

Formula:
C29H50O2
CAS Number(s):
10191-41-0, 59-02-9
SMILES code:

C[C@H](CCC[C@H](C)CCCC(C)C)CCC[C@@]1(C)CCc2c(O1)c(C)c(C)c(O)c2C

Source:
Pharm Eu 6.2