Alginic acid

Formula:
C6H10O7
CAS Number(s):
9005-32-7
SMILES code:

O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@@H]1O

Source:
Pharm Eu 6.2