Alfuzosin hydrochloride

Formula:
C19H28ClN5O4
CAS Number(s):
81403-68-1
SMILES code:

Cl.COc1cc2nc(nc(N)c2cc1OC)N(C)CCCNC(=O)C1CCCO1

Stoichiometry:
2/1
Source:
Pharm Eu 6.2
Powder Structure Patent No.:
US 5545738
Moisture Patent No.:
US 5545738