Alcuronium chloride

Formula:
C44H50Cl2N4O2
CAS Number(s):
15180-03-7
SMILES code:

[Cl-].[Cl-].OC/C=C/1\C[N+]2(CC=C)CC[C@@]34[C@H]2C[C@H]1C1=CN2c5ccccc5[C@]56 CC[N+]7(CC=C)C/C(=C\CO)/[C@@H](C[C@H]67)C(=CN(C41)c1ccccc31)C25

Source:
Pharm Eu 6.2