Albendazole

Formula:
C12H15N3O2S
CAS Number(s):
54965-21-8
SMILES code:

CCCSc1ccc2[nH]c(NC(=O)OC)nc2c1

Source:
Pharm Eu 6.2