Adrenaline tartrate

Formula:
C13H19NO9
CAS Number(s):
51-42-3
SMILES code:

CNC[C@H](O)c1ccc(O)c(O)c1.OC(=O)[C@H](O)[C@@H](O)C(=O)O

Source:
Pharm Eu 6.2