Adrenaline

Formula:
C9H13NO3
CAS Number(s):
51-43-4
SMILES code:

CNC[C@H](O)c1ccc(O)c(O)c1

Source:
Pharm Eu 6.2