Adenosine

Formula:
C10H13N5O4
CAS Number(s):
58-61-7
SMILES code:

OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)n1cnc2c(N)ncnc12

Source:
Pharm Eu 6.2