Acitretin

Formula:
C21H26O3
CAS Number(s):
55079-83-9
SMILES code:

COc1cc(C)c(/C=C/C(=C/C=C/C(=C/C(=O)O)/C)/C)c(C)c1C

Source:
Pharm Eu 6.2