Acetyltyrosine

Formula:
C11H13NO4
CAS Number(s):
2901-77-1, 537-55-3
SMILES code:

O=C(O)C(NC(=O)C)Cc1ccc(O)cc1

Source:
Pharm Eu 6.2