Acetyltryptophan

Formula:
C13H14N2O3
CAS Number(s):
1218-34-4, 2280-01-5, 87-32-1
SMILES code:

CC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O

Source:
Pharm Eu 6.2