Acetylcholine chloride

Formula:
C7H16ClNO2
CAS Number(s):
60-31-1
SMILES code:

[Cl-].CC(=O)OCC[N+](C)(C)C

Source:
Pharm Eu 6.2