Acetazolamide

Formula:
C4H6N4O3S2
CAS Number(s):
59-66-5
SMILES code:

CC(=O)Nc1nnc(s1)S(=O)(=O)N

Source:
Pharm Eu 6.2